C16H21NO4 — CID 59815494
(5-isocyano-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) 2,2-dimethylbutanoate (PubChem CID 59815494) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (5-isocyano-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) 2,2-dimethylbutanoate.
| Compound Name | (5-isocyano-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59815494 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (5-isocyano-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) 2,2-dimethylbutanoate |
| SMILES | [C-]#[N+]C1OC(=O)C2C3CC(OC(=O)C(C)(C)CC)C(C3)C12 |
| InChI | InChI=1S/C16H21NO4/c1-5-16(2,3)15(19)20-10-7-8-6-9(10)12-11(8)14(18)21-13(12)17-4/h8-13H,5-7H2,1-3H3 |
| InChIKey | QWTQFZYVPTXFIM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|