C17H22O7 — CID 89115462
[2-[(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate (PubChem CID 89115462) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is [2-[(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate.
| Compound Name | [2-[(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 89115462 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [2-[(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)OC1CC2CC1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C17H22O7/c1-4-17(2,3)16(21)22-7-11(18)23-10-6-8-5-9(10)13-12(8)14(19)24-15(13)20/h8-10,12-13H,4-7H2,1-3H3 |
| InChIKey | KHGBCMKFULRMME-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|