C13H20O6 — CID 67473202
[2-(5-methyl-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate (PubChem CID 67473202) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is [2-(5-methyl-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate.
| Compound Name | [2-(5-methyl-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 67473202 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | [2-(5-methyl-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)OC1CC(C)OC1=O |
| InChI | InChI=1S/C13H20O6/c1-5-13(3,4)12(16)17-7-10(14)19-9-6-8(2)18-11(9)15/h8-9H,5-7H2,1-4H3 |
| InChIKey | PDEVQEKHMWMUEI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|