C18H23NO6 — CID 170089351
[2-[(6-cyano-5-oxo-4-oxatricyclo[4.3.1.03,7]decan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate (PubChem CID 170089351) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is [2-[(6-cyano-5-oxo-4-oxatricyclo[4.3.1.03,7]decan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate.
| Compound Name | [2-[(6-cyano-5-oxo-4-oxatricyclo[4.3.1.03,7]decan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 170089351 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [2-[(6-cyano-5-oxo-4-oxatricyclo[4.3.1.03,7]decan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)OC1C2CCC3C1OC(=O)C3(C#N)C2 |
| InChI | InChI=1S/C18H23NO6/c1-4-17(2,3)15(21)23-8-12(20)24-13-10-5-6-11-14(13)25-16(22)18(11,7-10)9-19/h10-11,13-14H,4-8H2,1-3H3 |
| InChIKey | PJRGJIJRNLOMFV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|