About (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate
(7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate (PubChem CID 123377136) has the molecular formula C17H23NO4
and a molecular weight of 305.37 g/mol. Its IUPAC name is (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate.
Molecular Properties
| Compound Name | (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate |
| PubChem CID | 123377136 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate |
| SMILES | CCC(C)(CC)C(=O)OC1CC2CC3C1OC(=O)C3(C#N)C2 |
| InChI | InChI=1S/C17H23NO4/c1-4-16(3,5-2)14(19)21-12-7-10-6-11-13(12)22-15(20)17(11,8-10)9-18/h10-13H,4-8H2,1-3H3 |
| InChIKey | DCHCLEHSXXSXLB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate?
The IUPAC name of (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate (CID 123377136) is (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate.
What is the SMILES notation for (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate?
The canonical SMILES for (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate is CCC(C)(CC)C(=O)OC1CC2CC3C1OC(=O)C3(C#N)C2.
What is the InChIKey of (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate?
The InChIKey is DCHCLEHSXXSXLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4/c1-4-16(3,5-2)14(19)21-12-7-10-6-11-13(12)22-15(20)17(11,8-10)9-18/h10-13H,4-8H2,1-3H3.
What are the key properties of (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate?
(7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate has a molecular weight of 305.37 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-cyano-6-oxo-5-oxatricyclo[5.2.1.04,8]decan-3-yl) 2-ethyl-2-methylbutanoate is sourced from PubChem (CID 123377136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).