C18H23NO9 — CID 123578594
[2-[2-[(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2-oxoethoxy]-2-oxoethyl] 2-amino-2-methylbutanoate (PubChem CID 123578594) has the molecular formula C18H23NO9 and a molecular weight of 397.38 g/mol. Its IUPAC name is [2-[2-[(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2-oxoethoxy]-2-oxoethyl] 2-amino-2-methylbutanoate.
| Compound Name | [2-[2-[(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2-oxoethoxy]-2-oxoethyl] 2-amino-2-methylbutanoate |
|---|---|
| PubChem CID | 123578594 |
| Molecular Formula | C18H23NO9 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [2-[2-[(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)oxy]-2-oxoethoxy]-2-oxoethyl] 2-amino-2-methylbutanoate |
| SMILES | CCC(C)(N)C(=O)OCC(=O)OCC(=O)OC1CC2CC1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C18H23NO9/c1-3-18(2,19)17(24)26-6-11(20)25-7-12(21)27-10-5-8-4-9(10)14-13(8)15(22)28-16(14)23/h8-10,13-14H,3-7,19H2,1-2H3 |
| InChIKey | JUJUVWYALMKAMJ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 148.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|