C16H25NO6 — CID 163709236
[2-oxo-2-[[(5R)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]ethyl] 2-amino-2,3,3-trimethylbutanoate (PubChem CID 163709236) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is [2-oxo-2-[[(5R)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]ethyl] 2-amino-2,3,3-trimethylbutanoate.
| Compound Name | [2-oxo-2-[[(5R)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]ethyl] 2-amino-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 163709236 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | [2-oxo-2-[[(5R)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]ethyl] 2-amino-2,3,3-trimethylbutanoate |
| SMILES | CC(C)(C)C(C)(N)C(=O)OCC(=O)OC1CCC2C[C@H]1OC2=O |
| InChI | InChI=1S/C16H25NO6/c1-15(2,3)16(4,17)14(20)21-8-12(18)22-10-6-5-9-7-11(10)23-13(9)19/h9-11H,5-8,17H2,1-4H3/t9?,10?,11-,16?/m1/s1 |
| InChIKey | KHTGFWIQBGJRAW-VTYKSSSUSA-N |
| XLogP | 0.93 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|