C10H12FO7S- — CID 59616175
(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-fluoro-2-oxidoperoxysulfanylpropanoate (PubChem CID 59616175) has the molecular formula C10H12FO7S- and a molecular weight of 295.26 g/mol. Its IUPAC name is (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-fluoro-2-oxidoperoxysulfanylpropanoate.
| Compound Name | (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-fluoro-2-oxidoperoxysulfanylpropanoate |
|---|---|
| PubChem CID | 59616175 |
| Molecular Formula | C10H12FO7S- |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-fluoro-2-oxidoperoxysulfanylpropanoate |
| SMILES | CC(F)(SOO[O-])C(=O)OC1CCC2CC1OC2=O |
| InChI | InChI=1S/C10H13FO7S/c1-10(11,19-18-17-14)9(13)16-6-3-2-5-4-7(6)15-8(5)12/h5-7,14H,2-4H2,1H3/p-1 |
| InChIKey | QZFYVEVEKXUTLR-UHFFFAOYSA-M |
| XLogP | 0.18 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|