C13H16I2N2O6 — CID 147336023
[2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethyl] 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)propanoate (PubChem CID 147336023) has the molecular formula C13H16I2N2O6 and a molecular weight of 550.09 g/mol. Its IUPAC name is [2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethyl] 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)propanoate.
| Compound Name | [2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethyl] 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)propanoate |
|---|---|
| PubChem CID | 147336023 |
| Molecular Formula | C13H16I2N2O6 |
| Molecular Weight | 550.09 g/mol |
| Exact Mass | 549.91 |
| IUPAC Name | [2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethyl] 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)propanoate |
| SMILES | CC(I)(C(=O)OCC(=O)OC1CCC2CC1OC2=O)C12NI1N2 |
| InChI | InChI=1S/C13H16I2N2O6/c1-12(14,13-15(16-13)17-13)11(20)21-5-9(18)22-7-3-2-6-4-8(7)23-10(6)19/h6-8,16-17H,2-5H2,1H3 |
| InChIKey | DCOPLALCKCGULZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.09 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|