C13H16I2N2O4 — CID 152968008
(9-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)propanoate (PubChem CID 152968008) has the molecular formula C13H16I2N2O4 and a molecular weight of 518.09 g/mol. Its IUPAC name is (9-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)propanoate.
| Compound Name | (9-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)propanoate |
|---|---|
| PubChem CID | 152968008 |
| Molecular Formula | C13H16I2N2O4 |
| Molecular Weight | 518.09 g/mol |
| Exact Mass | 517.92 |
| IUPAC Name | (9-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)propanoate |
| SMILES | CC1C2CC3C(OC(=O)C13)C2OC(=O)C(C)(I)C12NI1N2 |
| InChI | InChI=1S/C13H16I2N2O4/c1-4-5-3-6-7(4)10(18)20-9(6)8(5)21-11(19)12(2,14)13-15(16-13)17-13/h4-9,16-17H,3H2,1-2H3 |
| InChIKey | URWZQWABWGXDPF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.09 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|