C14H11F4O8- — CID 164746286
2,2,3,3-tetrafluoro-4-[(9-methoxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-4-oxobutanoate (PubChem CID 164746286) has the molecular formula C14H11F4O8- and a molecular weight of 383.23 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-[(9-methoxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-4-oxobutanoate.
| Compound Name | 2,2,3,3-tetrafluoro-4-[(9-methoxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-4-oxobutanoate |
|---|---|
| PubChem CID | 164746286 |
| Molecular Formula | C14H11F4O8- |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-[(9-methoxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-4-oxobutanoate |
| SMILES | COC(=O)C1C2CC3C(OC(=O)C31)C2OC(=O)C(F)(F)C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C14H12F4O8/c1-24-9(19)5-3-2-4-6(5)10(20)25-7(4)8(3)26-12(23)14(17,18)13(15,16)11(21)22/h3-8H,2H2,1H3,(H,21,22)/p-1 |
| InChIKey | VVJHCCDLBRUHQR-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|