C23H23F4O8- — CID 164747341
4-[[9-(1-adamantyloxycarbonyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2,2,3,3-tetrafluoro-4-oxobutanoate (PubChem CID 164747341) has the molecular formula C23H23F4O8- and a molecular weight of 503.42 g/mol. Its IUPAC name is 4-[[9-(1-adamantyloxycarbonyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2,2,3,3-tetrafluoro-4-oxobutanoate.
| Compound Name | 4-[[9-(1-adamantyloxycarbonyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2,2,3,3-tetrafluoro-4-oxobutanoate |
|---|---|
| PubChem CID | 164747341 |
| Molecular Formula | C23H23F4O8- |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 4-[[9-(1-adamantyloxycarbonyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2,2,3,3-tetrafluoro-4-oxobutanoate |
| SMILES | O=C1OC2C3CC(C2OC(=O)C(F)(F)C(F)(F)C(=O)[O-])C(C(=O)OC24CC5CC(CC(C5)C2)C4)C13 |
| InChI | InChI=1S/C23H24F4O8/c24-22(25,19(30)31)23(26,27)20(32)34-16-12-4-11-13(17(28)33-15(11)16)14(12)18(29)35-21-5-8-1-9(6-21)3-10(2-8)7-21/h8-16H,1-7H2,(H,30,31)/p-1 |
| InChIKey | UPBNCZPWNTXMAM-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|