C22H26F2O9S — CID 121481224
1,1-difluoro-2-[[9-[(2-methyl-1-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid (PubChem CID 121481224) has the molecular formula C22H26F2O9S and a molecular weight of 504.50 g/mol. Its IUPAC name is 1,1-difluoro-2-[[9-[(2-methyl-1-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[9-[(2-methyl-1-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 121481224 |
| Molecular Formula | C22H26F2O9S |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 1,1-difluoro-2-[[9-[(2-methyl-1-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
| SMILES | CC1C2CC3CC(C2)CC1(OC(=O)C1C2CC4C(OC(=O)C41)C2OC(=O)C(F)(F)S(=O)(=O)O)C3 |
| InChI | InChI=1S/C22H26F2O9S/c1-8-11-3-9-2-10(4-11)7-21(8,6-9)33-19(26)15-13-5-12-14(15)18(25)31-16(12)17(13)32-20(27)22(23,24)34(28,29)30/h8-17H,2-7H2,1H3,(H,28,29,30) |
| InChIKey | LEIOSXIDRGXJCW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|