C25H30F2O11S — CID 88869935
2-[[9-[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 88869935) has the molecular formula C25H30F2O11S and a molecular weight of 576.57 g/mol. Its IUPAC name is 2-[[9-[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[9-[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88869935 |
| Molecular Formula | C25H30F2O11S |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 2-[[9-[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCC1(OC(=O)COC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)C(F)(F)S(=O)(=O)O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C25H30F2O11S/c1-2-24(12-4-10-3-11(6-12)7-13(24)5-10)38-16(28)9-35-21(29)17-14-8-15-18(17)22(30)36-19(15)20(14)37-23(31)25(26,27)39(32,33)34/h10-15,17-20H,2-9H2,1H3,(H,32,33,34) |
| InChIKey | QJTDOBCDZCRCJN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|