C24H30F2O9S — CID 88942352
1,1-difluoro-2-oxo-2-[[5-oxo-9-[(2-propan-2-yl-2-adamantyl)oxycarbonyl]-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid (PubChem CID 88942352) has the molecular formula C24H30F2O9S and a molecular weight of 532.56 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[[5-oxo-9-[(2-propan-2-yl-2-adamantyl)oxycarbonyl]-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[[5-oxo-9-[(2-propan-2-yl-2-adamantyl)oxycarbonyl]-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 88942352 |
| Molecular Formula | C24H30F2O9S |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[[5-oxo-9-[(2-propan-2-yl-2-adamantyl)oxycarbonyl]-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid |
| SMILES | CC(C)C1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)C(F)(F)S(=O)(=O)O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C24H30F2O9S/c1-9(2)23(12-4-10-3-11(6-12)7-13(23)5-10)35-21(28)17-15-8-14-16(17)20(27)33-18(14)19(15)34-22(29)24(25,26)36(30,31)32/h9-19H,3-8H2,1-2H3,(H,30,31,32) |
| InChIKey | UDIGSJRTRQFDJE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|