C22H26F2O9S — CID 58264683
(2-methyl-2-adamantyl) 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58264683) has the molecular formula C22H26F2O9S and a molecular weight of 504.50 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (2-methyl-2-adamantyl) 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 58264683 |
| Molecular Formula | C22H26F2O9S |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CC1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)C(F)(F)SOOO)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H26F2O9S/c1-21(10-3-8-2-9(5-10)6-11(21)4-8)31-19(26)15-13-7-12-14(15)18(25)29-16(12)17(13)30-20(27)22(23,24)34-33-32-28/h8-17,28H,2-7H2,1H3 |
| InChIKey | WIIPBLKBIPHJOO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|