C18H22F2O9S — CID 89027563
(1-methylcyclohexyl) 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 89027563) has the molecular formula C18H22F2O9S and a molecular weight of 452.43 g/mol. Its IUPAC name is (1-methylcyclohexyl) 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (1-methylcyclohexyl) 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 89027563 |
| Molecular Formula | C18H22F2O9S |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (1-methylcyclohexyl) 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CC1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)C(F)(F)SOOO)CCCCC1 |
| InChI | InChI=1S/C18H22F2O9S/c1-17(5-3-2-4-6-17)27-15(22)11-9-7-8-10(11)14(21)25-12(8)13(9)26-16(23)18(19,20)30-29-28-24/h8-13,24H,2-7H2,1H3 |
| InChIKey | FIHZCZBGXBRRCQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|