C20H23F2O11S- — CID 164728403
2-[2-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 164728403) has the molecular formula C20H23F2O11S- and a molecular weight of 509.46 g/mol. Its IUPAC name is 2-[2-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[2-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 164728403 |
| Molecular Formula | C20H23F2O11S- |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 2-[2-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CCC1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)COC(=O)C(F)(F)S(=O)(=O)[O-])CCCC1 |
| InChI | InChI=1S/C20H24F2O11S/c1-2-19(5-3-4-6-19)33-17(25)13-10-7-9-12(13)16(24)32-15(9)14(10)31-11(23)8-30-18(26)20(21,22)34(27,28)29/h9-10,12-15H,2-8H2,1H3,(H,27,28,29)/p-1 |
| InChIKey | KVTSHWQTECUBOU-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 162.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|