About (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate
(1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 168744026) has the molecular formula C22H32NO7+
and a molecular weight of 422.50 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| PubChem CID | 168744026 |
| Molecular Formula | C22H32NO7+ |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCC1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)C[NH+]2CCOCC2)CCCC1 |
| InChI | InChI=1S/C22H31NO7/c1-2-22(5-3-4-6-22)30-21(26)17-14-11-13-16(17)20(25)29-19(13)18(14)28-15(24)12-23-7-9-27-10-8-23/h13-14,16-19H,2-12H2,1H3/p+1 |
| InChIKey | SWYLGCMDDZSHAS-UHFFFAOYSA-O |
| XLogP | -0.11 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The IUPAC name of (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (CID 168744026) is (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
What is the SMILES notation for (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The canonical SMILES for (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate is CCC1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)C[NH+]2CCOCC2)CCCC1.
What is the InChIKey of (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The InChIKey is SWYLGCMDDZSHAS-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H31NO7/c1-2-22(5-3-4-6-22)30-21(26)17-14-11-13-16(17)20(25)29-19(13)18(14)28-15(24)12-23-7-9-27-10-8-23/h13-14,16-19H,2-12H2,1H3/p+1.
What are the key properties of (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
(1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate has a molecular weight of 422.50 g/mol, XLogP of -0.11, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 2-(2-morpholin-4-ium-4-ylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate is sourced from PubChem (CID 168744026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).