C23H28F3O11S- — CID 154598386
3-[4-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1,2-trifluoropropane-1-sulfonate (PubChem CID 154598386) has the molecular formula C23H28F3O11S- and a molecular weight of 569.53 g/mol. Its IUPAC name is 3-[4-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1,2-trifluoropropane-1-sulfonate.
| Compound Name | 3-[4-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1,2-trifluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 154598386 |
| Molecular Formula | C23H28F3O11S- |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | 3-[4-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1,2-trifluoropropane-1-sulfonate |
| SMILES | CCC1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)CCC(=O)OCC(F)C(F)(F)S(=O)(=O)[O-])CCCC1 |
| InChI | InChI=1S/C23H29F3O11S/c1-2-22(7-3-4-8-22)37-21(30)17-12-9-11-16(17)20(29)36-19(11)18(12)35-15(28)6-5-14(27)34-10-13(24)23(25,26)38(31,32)33/h11-13,16-19H,2-10H2,1H3,(H,31,32,33)/p-1 |
| InChIKey | ICRSHZZQSCJOEE-UHFFFAOYSA-M |
| XLogP | 1.77 |
| TPSA | 162.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|