C23H27F4O12S- — CID 154598383
4-[4-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate (PubChem CID 154598383) has the molecular formula C23H27F4O12S- and a molecular weight of 603.52 g/mol. Its IUPAC name is 4-[4-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate.
| Compound Name | 4-[4-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 154598383 |
| Molecular Formula | C23H27F4O12S- |
| Molecular Weight | 603.52 g/mol |
| Exact Mass | 603.12 |
| IUPAC Name | 4-[4-[[9-(1-ethylcyclopentyl)oxycarbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate |
| SMILES | CCC1(OC(=O)C2C3OC4C(OC(=O)C42)C3OC(=O)CCC(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])CCCC1 |
| InChI | InChI=1S/C23H28F4O12S/c1-2-21(7-3-4-8-21)39-20(31)14-13-15-18(38-19(13)30)17(16(14)37-15)36-12(29)6-5-11(28)35-10-9-22(24,25)23(26,27)40(32,33)34/h13-18H,2-10H2,1H3,(H,32,33,34)/p-1 |
| InChIKey | FBLWDGIOAUJVOU-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 171.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|