C25H34O8 — CID 59372770
(1-tert-butylcyclopentyl) 2-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 59372770) has the molecular formula C25H34O8 and a molecular weight of 462.54 g/mol. Its IUPAC name is (1-tert-butylcyclopentyl) 2-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (1-tert-butylcyclopentyl) 2-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 59372770 |
| Molecular Formula | C25H34O8 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (1-tert-butylcyclopentyl) 2-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | C=C(C)C(=O)OCCC(=O)OC1C2CC3C1OC(=O)C3C2C(=O)OC1(C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C25H34O8/c1-13(2)21(27)30-11-8-16(26)31-19-15-12-14-17(22(28)32-20(14)19)18(15)23(29)33-25(24(3,4)5)9-6-7-10-25/h14-15,17-20H,1,6-12H2,2-5H3 |
| InChIKey | KGXRMKDCMVAYQC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|