C16H20O7 — CID 126682089
methyl 2-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 126682089) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is methyl 2-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | methyl 2-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 126682089 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | methyl 2-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | C=C(C)C(=O)OCCOC1C2CC3C1OC(=O)C3C2C(=O)OC |
| InChI | InChI=1S/C16H20O7/c1-7(2)14(17)22-5-4-21-12-8-6-9-11(10(8)15(18)20-3)16(19)23-13(9)12/h8-13H,1,4-6H2,2-3H3 |
| InChIKey | IXAMZAHHWVTGQL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|