C19H17F5O6S — CID 177288065
[4-(pentafluoro-λ6-sulfanyl)phenyl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 177288065) has the molecular formula C19H17F5O6S and a molecular weight of 468.40 g/mol. Its IUPAC name is [4-(pentafluoro-λ6-sulfanyl)phenyl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | [4-(pentafluoro-λ6-sulfanyl)phenyl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 177288065 |
| Molecular Formula | C19H17F5O6S |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [4-(pentafluoro-λ6-sulfanyl)phenyl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | C=C(C)C(=O)OC1C2CC3C1OC(=O)C3C2C(=O)Oc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F5O6S/c1-8(2)17(25)29-15-11-7-12-14(19(27)30-16(12)15)13(11)18(26)28-9-3-5-10(6-4-9)31(20,21,22,23)24/h3-6,11-16H,1,7H2,2H3 |
| InChIKey | ZDEOUZYJUZQECG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|