C18H14F2I2O7 — CID 165109209
(4-hydroxy-3,5-diiodophenyl) 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 165109209) has the molecular formula C18H14F2I2O7 and a molecular weight of 634.11 g/mol. Its IUPAC name is (4-hydroxy-3,5-diiodophenyl) 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (4-hydroxy-3,5-diiodophenyl) 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 165109209 |
| Molecular Formula | C18H14F2I2O7 |
| Molecular Weight | 634.11 g/mol |
| Exact Mass | 633.88 |
| IUPAC Name | (4-hydroxy-3,5-diiodophenyl) 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CC(F)(F)C(=O)OC1C2CC3C1OC(=O)C3C2C(=O)Oc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C18H14F2I2O7/c1-18(19,20)17(26)29-14-7-4-6-11(16(25)28-13(6)14)10(7)15(24)27-5-2-8(21)12(23)9(22)3-5/h2-3,6-7,10-11,13-14,23H,4H2,1H3 |
| InChIKey | QRASGTGXXNEYQL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.11 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|