C17H23ClO6 — CID 67000727
tert-butyl 2-(4-chlorobutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 67000727) has the molecular formula C17H23ClO6 and a molecular weight of 358.82 g/mol. Its IUPAC name is tert-butyl 2-(4-chlorobutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | tert-butyl 2-(4-chlorobutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 67000727 |
| Molecular Formula | C17H23ClO6 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | tert-butyl 2-(4-chlorobutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C2CC3C(OC(=O)C31)C2OC(=O)CCCCl |
| InChI | InChI=1S/C17H23ClO6/c1-17(2,3)24-16(21)12-9-7-8-11(12)15(20)23-14(8)13(9)22-10(19)5-4-6-18/h8-9,11-14H,4-7H2,1-3H3 |
| InChIKey | QEGPLZSNTRKAIU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|