About (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate
(7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 166738308) has the molecular formula C22H29FO6
and a molecular weight of 408.47 g/mol. Its IUPAC name is (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
Molecular Properties
| Compound Name | (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| PubChem CID | 166738308 |
| Molecular Formula | C22H29FO6 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCC1CC2CC(C1)CC(OC(=O)C1C3CC4C(OC(=O)C41)C3OC(=O)CF)C2 |
| InChI | InChI=1S/C22H29FO6/c1-2-10-3-11-5-12(4-10)7-13(6-11)27-21(25)17-14-8-15-18(17)22(26)29-20(15)19(14)28-16(24)9-23/h10-15,17-20H,2-9H2,1H3 |
| InChIKey | DAUHPKYEVSJBBB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The IUPAC name of (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (CID 166738308) is (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
What is the SMILES notation for (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The canonical SMILES for (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate is CCC1CC2CC(C1)CC(OC(=O)C1C3CC4C(OC(=O)C41)C3OC(=O)CF)C2.
What is the InChIKey of (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The InChIKey is DAUHPKYEVSJBBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29FO6/c1-2-10-3-11-5-12(4-10)7-13(6-11)27-21(25)17-14-8-15-18(17)22(26)29-20(15)19(14)28-16(24)9-23/h10-15,17-20H,2-9H2,1H3.
What are the key properties of (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
(7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate has a molecular weight of 408.47 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-ethyl-3-bicyclo[3.3.1]nonanyl) 2-(2-fluoroacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate is sourced from PubChem (CID 166738308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).