C23H28F2O9S — CID 130308185
2-[[(1S)-9-[(2-ethyl-2-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 130308185) has the molecular formula C23H28F2O9S and a molecular weight of 518.53 g/mol. Its IUPAC name is 2-[[(1S)-9-[(2-ethyl-2-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[(1S)-9-[(2-ethyl-2-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 130308185 |
| Molecular Formula | C23H28F2O9S |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 2-[[(1S)-9-[(2-ethyl-2-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCC1(OC(=O)C2C3C(=O)OC4C3C[C@@H]2C4OC(=O)C(F)(F)S(=O)(=O)O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H28F2O9S/c1-2-22(11-4-9-3-10(6-11)7-12(22)5-9)34-20(27)16-14-8-13-15(16)19(26)32-17(13)18(14)33-21(28)23(24,25)35(29,30)31/h9-18H,2-8H2,1H3,(H,29,30,31)/t9?,10?,11?,12?,13?,14-,15?,16?,17?,18?,22?/m0/s1 |
| InChIKey | YZKMQWDGSNQRGT-YQSUNRBZSA-N |
| XLogP | 2.33 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|