C27H34F2O11S — CID 154598468
1,1-difluoro-2-[5-[[9-[(2-methyl-2-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-5-oxopentanoyl]oxyethanesulfonic acid (PubChem CID 154598468) has the molecular formula C27H34F2O11S and a molecular weight of 604.62 g/mol. Its IUPAC name is 1,1-difluoro-2-[5-[[9-[(2-methyl-2-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-5-oxopentanoyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[5-[[9-[(2-methyl-2-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-5-oxopentanoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 154598468 |
| Molecular Formula | C27H34F2O11S |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | 1,1-difluoro-2-[5-[[9-[(2-methyl-2-adamantyl)oxycarbonyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-5-oxopentanoyl]oxyethanesulfonic acid |
| SMILES | CC1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)CCCC(=O)OCC(F)(F)S(=O)(=O)O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C27H34F2O11S/c1-26(14-6-12-5-13(8-14)9-15(26)7-12)40-25(33)21-17-10-16-20(21)24(32)39-23(16)22(17)38-19(31)4-2-3-18(30)37-11-27(28,29)41(34,35)36/h12-17,20-23H,2-11H2,1H3,(H,34,35,36) |
| InChIKey | FERMYPZYQMUNKW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|