C18H22F2O12S — CID 154992592
1,1-difluoro-2-[4-[[9-(methoxymethoxycarbonyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxypropane-1-sulfonic acid (PubChem CID 154992592) has the molecular formula C18H22F2O12S and a molecular weight of 500.43 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-[[9-(methoxymethoxycarbonyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1-difluoro-2-[4-[[9-(methoxymethoxycarbonyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 154992592 |
| Molecular Formula | C18H22F2O12S |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 1,1-difluoro-2-[4-[[9-(methoxymethoxycarbonyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxypropane-1-sulfonic acid |
| SMILES | COCOC(=O)C1C2CC3C(OC(=O)C31)C2OC(=O)CCC(=O)OC(C)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H22F2O12S/c1-7(18(19,20)33(25,26)27)30-10(21)3-4-11(22)31-14-8-5-9-13(17(24)32-15(9)14)12(8)16(23)29-6-28-2/h7-9,12-15H,3-6H2,1-2H3,(H,25,26,27) |
| InChIKey | NGNDROFMJJGGOO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 168.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|