C22H28F2O13S — CID 154992497
2-[4-[[9-(cyclohexyloxymethoxycarbonyl)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid (PubChem CID 154992497) has the molecular formula C22H28F2O13S and a molecular weight of 570.52 g/mol. Its IUPAC name is 2-[4-[[9-(cyclohexyloxymethoxycarbonyl)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-[4-[[9-(cyclohexyloxymethoxycarbonyl)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 154992497 |
| Molecular Formula | C22H28F2O13S |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 2-[4-[[9-(cyclohexyloxymethoxycarbonyl)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CC(OC(=O)CCC(=O)OC1C2OC(=O)C3C2OC1C3C(=O)OCOC1CCCCC1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C22H28F2O13S/c1-10(22(23,24)38(29,30)31)34-12(25)7-8-13(26)35-18-16-14(15-17(36-16)19(18)37-21(15)28)20(27)33-9-32-11-5-3-2-4-6-11/h10-11,14-19H,2-9H2,1H3,(H,29,30,31) |
| InChIKey | TWBMLIBRLQUPBX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|