C26H34F2O13S — CID 159756153
2-[4-[[9-[1-(2-bicyclo[2.2.1]heptanyloxy)-2-methylpropoxy]carbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid (PubChem CID 159756153) has the molecular formula C26H34F2O13S and a molecular weight of 624.61 g/mol. Its IUPAC name is 2-[4-[[9-[1-(2-bicyclo[2.2.1]heptanyloxy)-2-methylpropoxy]carbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-[4-[[9-[1-(2-bicyclo[2.2.1]heptanyloxy)-2-methylpropoxy]carbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 159756153 |
| Molecular Formula | C26H34F2O13S |
| Molecular Weight | 624.61 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | 2-[4-[[9-[1-(2-bicyclo[2.2.1]heptanyloxy)-2-methylpropoxy]carbonyl-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CC(C)C(OC(=O)C1C2OC3C(OC(=O)C31)C2OC(=O)CCC(=O)OC(C)C(F)(F)S(=O)(=O)O)OC1CC2CCC1C2 |
| InChI | InChI=1S/C26H34F2O13S/c1-10(2)25(37-14-9-12-4-5-13(14)8-12)41-24(32)18-17-20-22(40-23(17)31)21(19(18)39-20)38-16(30)7-6-15(29)36-11(3)26(27,28)42(33,34)35/h10-14,17-22,25H,4-9H2,1-3H3,(H,33,34,35) |
| InChIKey | UWLRRTCSLFGJAJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.61 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|