C24H32F2O6 — CID 170089429
(2-ethyl-2-adamantyl) 2-(2,2-difluoro-1-hydroxypropoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 170089429) has the molecular formula C24H32F2O6 and a molecular weight of 454.51 g/mol. Its IUPAC name is (2-ethyl-2-adamantyl) 2-(2,2-difluoro-1-hydroxypropoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (2-ethyl-2-adamantyl) 2-(2,2-difluoro-1-hydroxypropoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 170089429 |
| Molecular Formula | C24H32F2O6 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | (2-ethyl-2-adamantyl) 2-(2,2-difluoro-1-hydroxypropoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCC1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(O)C(C)(F)F)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C24H32F2O6/c1-3-24(12-5-10-4-11(7-12)8-13(24)6-10)32-21(28)17-15-9-14-16(17)20(27)30-18(14)19(15)31-22(29)23(2,25)26/h10-19,22,29H,3-9H2,1-2H3 |
| InChIKey | SLKBFJCTTGCUFL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|