C15H21IO6 — CID 129121513
ethyl 2-(1-hydroxy-2-iodobutoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 129121513) has the molecular formula C15H21IO6 and a molecular weight of 424.23 g/mol. Its IUPAC name is ethyl 2-(1-hydroxy-2-iodobutoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | ethyl 2-(1-hydroxy-2-iodobutoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 129121513 |
| Molecular Formula | C15H21IO6 |
| Molecular Weight | 424.23 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | ethyl 2-(1-hydroxy-2-iodobutoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCOC(=O)C1C2CC3C(OC(=O)C31)C2OC(O)C(I)CC |
| InChI | InChI=1S/C15H21IO6/c1-3-8(16)13(17)21-11-6-5-7-10(15(19)22-12(7)11)9(6)14(18)20-4-2/h6-13,17H,3-5H2,1-2H3 |
| InChIKey | FUTXGNRWRUIKQP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|