C13H18O9S — CID 169012901
2-[2-(1-hydroxyethoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid (PubChem CID 169012901) has the molecular formula C13H18O9S and a molecular weight of 350.35 g/mol. Its IUPAC name is 2-[2-(1-hydroxyethoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid.
| Compound Name | 2-[2-(1-hydroxyethoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 169012901 |
| Molecular Formula | C13H18O9S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-[2-(1-hydroxyethoxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid |
| SMILES | CC(O)OC1C2CC3C1OC(=O)C3C2C(=O)OCCS(=O)(=O)O |
| InChI | InChI=1S/C13H18O9S/c1-5(14)21-10-6-4-7-9(13(16)22-11(7)10)8(6)12(15)20-2-3-23(17,18)19/h5-11,14H,2-4H2,1H3,(H,17,18,19) |
| InChIKey | QUMMEEXDMISWGY-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|