C11H13BrO4 — CID 124837487
ethyl (1R,2R,3S,6R,7R,9S)-2-bromo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 124837487) has the molecular formula C11H13BrO4 and a molecular weight of 289.13 g/mol. Its IUPAC name is ethyl (1R,2R,3S,6R,7R,9S)-2-bromo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | ethyl (1R,2R,3S,6R,7R,9S)-2-bromo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 124837487 |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | ethyl (1R,2R,3S,6R,7R,9S)-2-bromo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C[C@H]3[C@H](OC(=O)[C@H]31)[C@@H]2Br |
| InChI | InChI=1S/C11H13BrO4/c1-2-15-10(13)6-4-3-5-7(6)11(14)16-9(5)8(4)12/h4-9H,2-3H2,1H3/t4-,5-,6-,7-,8-,9+/m1/s1 |
| InChIKey | UNAVIWIODDXNOP-MVEQLIQHSA-N |
| XLogP | 1.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|