C14H18BrNO3 — CID 4895503
2-bromo-9-(piperidine-1-carbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 4895503) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is 2-bromo-9-(piperidine-1-carbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
| Compound Name | 2-bromo-9-(piperidine-1-carbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
|---|---|
| PubChem CID | 4895503 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-bromo-9-(piperidine-1-carbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | O=C1OC2C(Br)C3CC2C1C3C(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H18BrNO3/c15-11-7-6-8-10(14(18)19-12(8)11)9(7)13(17)16-4-2-1-3-5-16/h7-12H,1-6H2 |
| InChIKey | PXLZBHUORXEGAS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|