C9H11BrO3 — CID 98723623
(1S,2R,3S,6R,7R,9S)-2-bromo-9-(hydroxymethyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 98723623) has the molecular formula C9H11BrO3 and a molecular weight of 247.09 g/mol. Its IUPAC name is (1S,2R,3S,6R,7R,9S)-2-bromo-9-(hydroxymethyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
| Compound Name | (1S,2R,3S,6R,7R,9S)-2-bromo-9-(hydroxymethyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
|---|---|
| PubChem CID | 98723623 |
| Molecular Formula | C9H11BrO3 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | (1S,2R,3S,6R,7R,9S)-2-bromo-9-(hydroxymethyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | O=C1O[C@@H]2[C@H](Br)[C@H]3C[C@@H]2[C@H]1[C@@H]3CO |
| InChI | InChI=1S/C9H11BrO3/c10-7-3-1-4-6(5(3)2-11)9(12)13-8(4)7/h3-8,11H,1-2H2/t3-,4+,5+,6-,7+,8-/m0/s1 |
| InChIKey | WYAMFMPLCTVLBL-MZNFZHPNSA-N |
| XLogP | 0.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|