C14H18O6S — CID 170203007
2-methylsulfanylethyl 2-acetyloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 170203007) has the molecular formula C14H18O6S and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-methylsulfanylethyl 2-acetyloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2-methylsulfanylethyl 2-acetyloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 170203007 |
| Molecular Formula | C14H18O6S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-methylsulfanylethyl 2-acetyloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CSCCOC(=O)C1C2CC3C(OC(=O)C31)C2OC(C)=O |
| InChI | InChI=1S/C14H18O6S/c1-6(15)19-11-7-5-8-10(14(17)20-12(8)11)9(7)13(16)18-3-4-21-2/h7-12H,3-5H2,1-2H3 |
| InChIKey | URAFOAVWWMQBSL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|