C23H30O6S — CID 146539463
3-sulfanylpropyl 2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 146539463) has the molecular formula C23H30O6S and a molecular weight of 434.55 g/mol. Its IUPAC name is 3-sulfanylpropyl 2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 3-sulfanylpropyl 2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 146539463 |
| Molecular Formula | C23H30O6S |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 3-sulfanylpropyl 2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C1OC2C3CC(C2OC(=O)C24CC5CC(CC(C5)C2)C4)C(C(=O)OCCCS)C13 |
| InChI | InChI=1S/C23H30O6S/c24-20(27-2-1-3-30)16-14-7-15-17(16)21(25)28-18(15)19(14)29-22(26)23-8-11-4-12(9-23)6-13(5-11)10-23/h11-19,30H,1-10H2 |
| InChIKey | BVKYFNUHDKLDKG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|