C32H39O9S- — CID 140705909
4-[2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-2,6-di(propan-2-yl)benzenesulfonate (PubChem CID 140705909) has the molecular formula C32H39O9S- and a molecular weight of 599.72 g/mol. Its IUPAC name is 4-[2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-2,6-di(propan-2-yl)benzenesulfonate.
| Compound Name | 4-[2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-2,6-di(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 140705909 |
| Molecular Formula | C32H39O9S- |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | 4-[2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-2,6-di(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)C23CC4CC(CC(C4)C2)C3)cc(C(C)C)c1S(=O)(=O)[O-] |
| InChI | InChI=1S/C32H40O9S/c1-14(2)20-8-19(9-21(15(3)4)28(20)42(36,37)38)39-29(33)24-23-10-22-25(24)30(34)40-26(22)27(23)41-31(35)32-11-16-5-17(12-32)7-18(6-16)13-32/h8-9,14-18,22-27H,5-7,10-13H2,1-4H3,(H,36,37,38)/p-1 |
| InChIKey | DYAIUNIQILZZPW-UHFFFAOYSA-M |
| XLogP | 4.68 |
| TPSA | 136.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|