C32H42O6S — CID 167133768
[2,6-di(propan-2-yl)-4-sulfanylphenyl] 8-(adamantane-1-carbonyloxy)-7-methyl-3-oxo-2-oxabicyclo[3.2.1]octane-4-carboxylate (PubChem CID 167133768) has the molecular formula C32H42O6S and a molecular weight of 554.75 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)-4-sulfanylphenyl] 8-(adamantane-1-carbonyloxy)-7-methyl-3-oxo-2-oxabicyclo[3.2.1]octane-4-carboxylate.
| Compound Name | [2,6-di(propan-2-yl)-4-sulfanylphenyl] 8-(adamantane-1-carbonyloxy)-7-methyl-3-oxo-2-oxabicyclo[3.2.1]octane-4-carboxylate |
|---|---|
| PubChem CID | 167133768 |
| Molecular Formula | C32H42O6S |
| Molecular Weight | 554.75 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | [2,6-di(propan-2-yl)-4-sulfanylphenyl] 8-(adamantane-1-carbonyloxy)-7-methyl-3-oxo-2-oxabicyclo[3.2.1]octane-4-carboxylate |
| SMILES | CC(C)c1cc(S)cc(C(C)C)c1OC(=O)C1C(=O)OC2C(C)CC1C2OC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H42O6S/c1-15(2)22-10-21(39)11-23(16(3)4)27(22)37-30(34)25-24-6-17(5)26(36-29(25)33)28(24)38-31(35)32-12-18-7-19(13-32)9-20(8-18)14-32/h10-11,15-20,24-26,28,39H,6-9,12-14H2,1-5H3 |
| InChIKey | RVWILLUKSWSDKA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.75 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|