C11H14F3NO5 — CID 162589648
2,2,2-trifluoroethyl 8-aminooxy-7-methyl-3-oxo-2-oxabicyclo[3.2.1]octane-4-carboxylate (PubChem CID 162589648) has the molecular formula C11H14F3NO5 and a molecular weight of 297.23 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 8-aminooxy-7-methyl-3-oxo-2-oxabicyclo[3.2.1]octane-4-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 8-aminooxy-7-methyl-3-oxo-2-oxabicyclo[3.2.1]octane-4-carboxylate |
|---|---|
| PubChem CID | 162589648 |
| Molecular Formula | C11H14F3NO5 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2,2,2-trifluoroethyl 8-aminooxy-7-methyl-3-oxo-2-oxabicyclo[3.2.1]octane-4-carboxylate |
| SMILES | CC1CC2C(C(=O)OCC(F)(F)F)C(=O)OC1C2ON |
| InChI | InChI=1S/C11H14F3NO5/c1-4-2-5-6(9(16)18-3-11(12,13)14)10(17)19-7(4)8(5)20-15/h4-8H,2-3,15H2,1H3 |
| InChIKey | HKJHEKXUUPPRHJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|