C21H27F3O9 — CID 89458653
2,2,2-trifluoroethyl 9-(2,2-dimethylbutanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate (PubChem CID 89458653) has the molecular formula C21H27F3O9 and a molecular weight of 480.43 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 9-(2,2-dimethylbutanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 9-(2,2-dimethylbutanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 89458653 |
| Molecular Formula | C21H27F3O9 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2,2,2-trifluoroethyl 9-(2,2-dimethylbutanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2C3OC4(CCC(C(=O)OCC(F)(F)F)CC4)OC3OC12 |
| InChI | InChI=1S/C21H27F3O9/c1-4-19(2,3)18(27)31-13-11-12(29-16(13)26)14-17(30-11)33-20(32-14)7-5-10(6-8-20)15(25)28-9-21(22,23)24/h10-14,17H,4-9H2,1-3H3 |
| InChIKey | SBILZOFTDQJQLE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|