C21H20F6O7 — CID 59371082
[(1S,2R,6R,8S,9S)-4-[3,5-bis(trifluoromethyl)phenyl]-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylbutanoate (PubChem CID 59371082) has the molecular formula C21H20F6O7 and a molecular weight of 498.37 g/mol. Its IUPAC name is [(1S,2R,6R,8S,9S)-4-[3,5-bis(trifluoromethyl)phenyl]-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,2R,6R,8S,9S)-4-[3,5-bis(trifluoromethyl)phenyl]-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59371082 |
| Molecular Formula | C21H20F6O7 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [(1S,2R,6R,8S,9S)-4-[3,5-bis(trifluoromethyl)phenyl]-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@@H]1C(=O)O[C@@H]2[C@H]3OC(c4cc(C(F)(F)F)cc(C(F)(F)F)c4)O[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C21H20F6O7/c1-4-19(2,3)18(29)33-13-11-12(30-15(13)28)14-17(31-11)34-16(32-14)8-5-9(20(22,23)24)7-10(6-8)21(25,26)27/h5-7,11-14,16-17H,4H2,1-3H3/t11-,12-,13-,14+,16?,17+/m0/s1 |
| InChIKey | LZDCQJNLVGHYHV-UPUHNGDASA-N |
| XLogP | 4.14 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |