C24H34F2O11Si — CID 58445728
trimethylsilylmethyl 9-[2-(2,2-dimethylbutanoyloxy)acetyl]oxy-2',2'-difluoro-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,5'-cyclopentane]-1'-carboxylate (PubChem CID 58445728) has the molecular formula C24H34F2O11Si and a molecular weight of 564.61 g/mol. Its IUPAC name is trimethylsilylmethyl 9-[2-(2,2-dimethylbutanoyloxy)acetyl]oxy-2',2'-difluoro-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,5'-cyclopentane]-1'-carboxylate.
| Compound Name | trimethylsilylmethyl 9-[2-(2,2-dimethylbutanoyloxy)acetyl]oxy-2',2'-difluoro-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,5'-cyclopentane]-1'-carboxylate |
|---|---|
| PubChem CID | 58445728 |
| Molecular Formula | C24H34F2O11Si |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | trimethylsilylmethyl 9-[2-(2,2-dimethylbutanoyloxy)acetyl]oxy-2',2'-difluoro-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,5'-cyclopentane]-1'-carboxylate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)OC1C(=O)OC2C3OC4(CCC(F)(F)C4C(=O)OC[Si](C)(C)C)OC3OC12 |
| InChI | InChI=1S/C24H34F2O11Si/c1-7-22(2,3)21(30)31-10-12(27)33-15-13-14(34-18(15)28)16-20(35-13)37-24(36-16)9-8-23(25,26)17(24)19(29)32-11-38(4,5)6/h13-17,20H,7-11H2,1-6H3 |
| InChIKey | AUUBCEYTQTYTON-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|