C24H34O8 — CID 163883923
(9-ethoxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl)methyl 2,2-dimethylpropanoate (PubChem CID 163883923) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is (9-ethoxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl)methyl 2,2-dimethylpropanoate.
| Compound Name | (9-ethoxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl)methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163883923 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (9-ethoxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl)methyl 2,2-dimethylpropanoate |
| SMILES | CCOC1C(=O)OC2C3OC4(OC3OC12)C1CC2CC4CC(COC(=O)C(C)(C)C)(C2)C1 |
| InChI | InChI=1S/C24H34O8/c1-5-27-17-15-16(29-19(17)25)18-20(30-15)32-24(31-18)13-6-12-7-14(24)10-23(8-12,9-13)11-28-21(26)22(2,3)4/h12-18,20H,5-11H2,1-4H3 |
| InChIKey | OAUMLEGNGZVIJF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |