C22H27F2O12S- — CID 169026994
[9-(1-ethoxyethoxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl] 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 169026994) has the molecular formula C22H27F2O12S- and a molecular weight of 553.51 g/mol. Its IUPAC name is [9-(1-ethoxyethoxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl] 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | [9-(1-ethoxyethoxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl] 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 169026994 |
| Molecular Formula | C22H27F2O12S- |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | [9-(1-ethoxyethoxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl] 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | CCOC(C)OC1C(=O)OC2C3OC4(OC3OC12)C1CC2CC4CC(OC(=O)C(F)(F)SOO[O-])(C2)C1 |
| InChI | InChI=1S/C22H28F2O12S/c1-3-28-9(2)29-15-13-14(30-17(15)25)16-18(31-13)33-21(32-16)11-4-10-5-12(21)8-20(6-10,7-11)34-19(26)22(23,24)37-36-35-27/h9-16,18,27H,3-8H2,1-2H3/p-1 |
| InChIKey | BSSCDCBVQHWRNL-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|