C21H32F2O6 — CID 161143212
[5-(1-ethoxyethoxymethyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl] 2,2-difluoropropanoate (PubChem CID 161143212) has the molecular formula C21H32F2O6 and a molecular weight of 418.48 g/mol. Its IUPAC name is [5-(1-ethoxyethoxymethyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl] 2,2-difluoropropanoate.
| Compound Name | [5-(1-ethoxyethoxymethyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl] 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 161143212 |
| Molecular Formula | C21H32F2O6 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | [5-(1-ethoxyethoxymethyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl] 2,2-difluoropropanoate |
| SMILES | CCOC(C)OCC1COC2(OC1)C1CC3CC2CC(OC(=O)C(C)(F)F)(C3)C1 |
| InChI | InChI=1S/C21H32F2O6/c1-4-25-13(2)26-10-15-11-27-21(28-12-15)16-5-14-6-17(21)9-20(7-14,8-16)29-18(24)19(3,22)23/h13-17H,4-12H2,1-3H3 |
| InChIKey | RZEMGWZABXKWQD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|