C17H17F6O6- — CID 177105951
2,2-difluoro-3-oxo-3-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl)oxypropanoate (PubChem CID 177105951) has the molecular formula C17H17F6O6- and a molecular weight of 431.31 g/mol. Its IUPAC name is 2,2-difluoro-3-oxo-3-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl)oxypropanoate.
| Compound Name | 2,2-difluoro-3-oxo-3-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl)oxypropanoate |
|---|---|
| PubChem CID | 177105951 |
| Molecular Formula | C17H17F6O6- |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2,2-difluoro-3-oxo-3-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl)oxypropanoate |
| SMILES | O=C([O-])C(F)(F)C(=O)OC12CC3CC(C1)C1(OCC(F)(F)C(F)(F)CO1)C(C3)C2 |
| InChI | InChI=1S/C17H18F6O6/c18-14(19)6-27-17(28-7-15(14,20)21)9-1-8-2-10(17)5-13(3-8,4-9)29-12(26)16(22,23)11(24)25/h8-10H,1-7H2,(H,24,25)/p-1 |
| InChIKey | HRXOBEXHXOJRFY-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|